(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid
(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid
PubChem CID: 18392195
Ethyl glucuronide is a beta-D-glucosiduronic acid that is the ethyl derivative of beta-D-glucuronic acid. It has a role as a human urinary metabolite.
Canonical SMILES
SMILES: CCOC1C(C(C(C(O1)C(=O)O)O)O)OIsomeric SMILES
SMILES: CCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)OThis platform is for informational purposes only and does not constitute medical advice. Always consult a qualified healthcare professional.
Trials and conditions connected to Ethyl beta-D-glucuronide